cas: 25197-99-3 — see every product listed under this CAS number, including other names
5-Bromo-L-tryptophan, 97%, 97% (CAS 25197-99-3) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g, 25g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch113QUF-100mg |
| cas | 25197-99-3 |
| size | 100mg |
| availability | 125g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 107.60 Pln | |
| Chemat | 250mg | 155.60 Pln | |
| Chemat | 1g | 347.60 Pln | |
| Chemat | 5g | 1158.80 Pln | |
| Chemat | 10g | 1619.60 Pln | |
| Chemat | 25g | 3794.00 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
(2S)-2-amino-3-(5-bromo-1H-indol-3-yl)propanoic acid (CAS 25197-99-3) is a chemical compound with the molecular formula C11H11BrN2O2 and a molecular weight of 283.12 g/mol. IUPAC name: (2S)-2-amino-3-(5-bromo-1H-indol-3-yl)propanoic acid. InChIKey: KZDNJQUJBMDHJW-VIFPVBQESA-N.
| Molecular formula | C11H11BrN2O2 |
|---|---|
| Molecular weight | 283.12 g/mol |
| IUPAC name | (2S)-2-amino-3-(5-bromo-1H-indol-3-yl)propanoic acid |
| InChIKey | KZDNJQUJBMDHJW-VIFPVBQESA-N |
| SMILES | C1=CC2=C(C=C1Br)C(=CN2)C[C@@H](C(=O)O)N |
Computed by PubChem (NCBI)