cas: 25197-99-3 — see every product listed under this CAS number, including other names
5-Bromo-L-tryptophan, 99.79% (CAS 25197-99-3) is a chemical reagent available from Chemat. Available pack sizes: 5 g, 250 mg, 1 g. Offered by: MedChemExpress.
| brand | MedChemExpress |
|---|---|
| catalog number | HY-20897A-5 g |
| cas | 25197-99-3 |
| size | 5 g |
| availability | In stock |
| brand | size | price | |
|---|---|---|---|
| MedChemExpress | 5 g | 1411.03 Pln | |
| MedChemExpress | 250 mg | 240.74 Pln | |
| MedChemExpress | 1 g | 477.59 Pln |
| delivery time | 2-3 weeks |
|---|---|
| purity | 99.79% |
(2S)-2-amino-3-(5-bromo-1H-indol-3-yl)propanoic acid (CAS 25197-99-3) is a chemical compound with the molecular formula C11H11BrN2O2 and a molecular weight of 283.12 g/mol. IUPAC name: (2S)-2-amino-3-(5-bromo-1H-indol-3-yl)propanoic acid. InChIKey: KZDNJQUJBMDHJW-VIFPVBQESA-N.
| Molecular formula | C11H11BrN2O2 |
|---|---|
| Molecular weight | 283.12 g/mol |
| IUPAC name | (2S)-2-amino-3-(5-bromo-1H-indol-3-yl)propanoic acid |
| InChIKey | KZDNJQUJBMDHJW-VIFPVBQESA-N |
| SMILES | C1=CC2=C(C=C1Br)C(=CN2)C[C@@H](C(=O)O)N |
Computed by PubChem (NCBI)