5-Bromobenzofuran-2-carboxamide, 98%
cas: 35351-21-4 — see every product listed under this CAS number, including other names
5-Bromobenzofuran-2-carboxamide, 98% (CAS 35351-21-4) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g, 250mg. Offered by: Ambeed, Chemat, BLDpharm.
| brand | Ambeed |
|---|---|
| catalog number | A943499-1g |
| cas | 35351-21-4 |
| size | 1g |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 1g | 286.94 Pln | |
| Ambeed | 5g | 926.62 Pln | |
| Ambeed | 10g | 1571.88 Pln | |
| Ambeed | 25g | 3073.75 Pln | |
| Chemat | 250mg | 136.40 Pln | |
| Chemat | 1g | 280.40 Pln | |
| Chemat | 5g | 928.40 Pln | |
| Chemat | 10g | 1576.40 Pln | |
| Chemat | 25g | 3088.40 Pln | |
| BLDpharm | 1g | 303.25 Pln | |
| BLDpharm | 5g | 991.90 Pln | |
| BLDpharm | 10g | 1691.65 Pln | |
| BLDpharm | 25g | 3313.30 Pln |
properties
| purity | 98% |
|---|---|
| delivery time | 2-3 weeks |
5-bromo-1-benzofuran-2-carboxamide (CAS 35351-21-4) is a chemical compound with the molecular formula C9H6BrNO2 and a molecular weight of 240.05 g/mol. IUPAC name: 5-bromo-1-benzofuran-2-carboxamide. InChIKey: VYOHEOKELADMTR-UHFFFAOYSA-N.
| Molecular formula | C9H6BrNO2 |
|---|---|
| Molecular weight | 240.05 g/mol |
| IUPAC name | 5-bromo-1-benzofuran-2-carboxamide |
| InChIKey | VYOHEOKELADMTR-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C1Br)C=C(O2)C(=O)N |
Computed by PubChem (NCBI)