Products 108938-16-5
CAS 108938-16-5 appears in our catalog under these names: 7-Bromo-5-methylisatin, ≥95%, ≥95%, 7-Bromo-5-methylindoline-2,3-dione, 98%, 7-bromo-5-methyl-1H-indole-2,3-dione. Offered by: Chemat, Combi-blocks, Fluorochem. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g.
7-bromo-5-methyl-1H-indole-2,3-dione (CAS 108938-16-5) is a chemical compound with the molecular formula C9H6BrNO2 and a molecular weight of 240.05 g/mol. IUPAC name: 7-bromo-5-methyl-1H-indole-2,3-dione. InChIKey: NPDJRIGMWAQKTQ-UHFFFAOYSA-N.
| Molecular formula | C9H6BrNO2 |
|---|---|
| Molecular weight | 240.05 g/mol |
| IUPAC name | 7-bromo-5-methyl-1H-indole-2,3-dione |
| InChIKey | NPDJRIGMWAQKTQ-UHFFFAOYSA-N |
| SMILES | CC1=CC2=C(C(=C1)Br)NC(=O)C2=O |
Computed by PubChem (NCBI)
Synonyms:
7-Bromo-5-methylindoline-2,3-dione, 7-bromo-5-methylisatin, 7-Bromo-5-methyl-1H-indole-2,3-dione, 1H-Indole-2,3-dione,7-bromo-5-methyl-, 7-bromo-5-methyl-indoline-2,3-dione, 7-bromo-5-methyl-1H-benzo[d]azolidine-2,3-dione, 4kwg, 5-Methyl-7-bromoisatin, Cambridge id 6378722, 1H-Indole-2,3-dione, 7-bromo-5-methyl-