CAS 19165-25-4 appears in our catalog under these names: 6-Bromo-2-methyl-4h-3,1-benzoxazin-4-one, 96%, 6-Bromo-2-methyl-4H-benzo(d)(1,3)oxazin-4-one, 98%, 6-Bromo-2-methyl-4H-benzo[d][1,3]oxazin-4-one, 95%, 95%. Offered by: Combi-blocks, AmBeed, Chemat. Available pack sizes: 10g, 5g, 25g, 1g, 100mg, 250mg.
6-bromo-2-methyl-3,1-benzoxazin-4-one (CAS 19165-25-4) is a chemical compound with the molecular formula C9H6BrNO2 and a molecular weight of 240.05 g/mol. IUPAC name: 6-bromo-2-methyl-3,1-benzoxazin-4-one. InChIKey: JCRULBKTDUOWMP-UHFFFAOYSA-N.
| Molecular formula | C9H6BrNO2 |
|---|---|
| Molecular weight | 240.05 g/mol |
| IUPAC name | 6-bromo-2-methyl-3,1-benzoxazin-4-one |
| InChIKey | JCRULBKTDUOWMP-UHFFFAOYSA-N |
| SMILES | CC1=NC2=C(C=C(C=C2)Br)C(=O)O1 |
Computed by PubChem (NCBI)