Products 10406-06-1
CAS 10406-06-1 appears in our catalog under these names: 5-Bromo-1H-indole-3-carboxylic acid, 97%, 5-Bromoindole-3-carboxylic Acid, >98.0%(HPLC)(T), 5-Bromo-1H-indole-3-carboxylic acid 97%, 5-Bromo-1H-indole-3-carboxylic acid, 97%, 97%, 5-Bromo-indole-3-carboxylic acid, 98%. Offered by: Combi-blocks, TCI, Ambeed, Chemat, Fluorochem. Available pack sizes: 10g, 100g, 5g, 25g, 1g, 250mg.
5-bromo-1H-indole-3-carboxylic acid (CAS 10406-06-1) is a chemical compound with the molecular formula C9H6BrNO2 and a molecular weight of 240.05 g/mol. IUPAC name: 5-bromo-1H-indole-3-carboxylic acid. InChIKey: JVZMBSGNSAHFCY-UHFFFAOYSA-N.
| Molecular formula | C9H6BrNO2 |
|---|---|
| Molecular weight | 240.05 g/mol |
| IUPAC name | 5-bromo-1H-indole-3-carboxylic acid |
| InChIKey | JVZMBSGNSAHFCY-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C1Br)C(=CN2)C(=O)O |
Computed by PubChem (NCBI)