5-Chloro-1-(4-methoxyphenyl)-1-oxopentane, 95%
cas: 949-06-4 — see every product listed under this CAS number, including other names
5-Chloro-1-(4-methoxyphenyl)-1-oxopentane, 95% (CAS 949-06-4) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 100mg. Offered by: Ambeed, BLDpharm, Chemat, Fluorochem.
| brand | Ambeed |
|---|---|
| catalog number | A932109-250mg |
| cas | 949-06-4 |
| size | 250mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 320.31 Pln | |
| Ambeed | 1g | 815.38 Pln | |
| Ambeed | 5g | 3051.50 Pln | |
| BLDpharm | 100mg | 181.07 Pln | |
| BLDpharm | 250mg | 314.36 Pln | |
| BLDpharm | 1g | 803.08 Pln | |
| BLDpharm | 5g | 2991.19 Pln | |
| Chemat | 100mg | 136.40 Pln | |
| Chemat | 250mg | 227.60 Pln | |
| Chemat | 1g | 568.40 Pln | |
| Fluorochem | 1g | 1044.44 Pln |
properties
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks |
5-chloro-1-(4-methoxyphenyl)pentan-1-one (CAS 949-06-4) is a chemical compound with the molecular formula C12H15ClO2 and a molecular weight of 226.70 g/mol. IUPAC name: 5-chloro-1-(4-methoxyphenyl)pentan-1-one. InChIKey: YYSTYNWZWNOXOQ-UHFFFAOYSA-N.
| Molecular formula | C12H15ClO2 |
|---|---|
| Molecular weight | 226.70 g/mol |
| IUPAC name | 5-chloro-1-(4-methoxyphenyl)pentan-1-one |
| InChIKey | YYSTYNWZWNOXOQ-UHFFFAOYSA-N |
| SMILES | COC1=CC=C(C=C1)C(=O)CCCCCl |
Computed by PubChem (NCBI)