CAS 1872907-39-5 appears in our catalog under these names: 4-Chloro-2-methyl-benzoic acid tert-butyl ester, 95%, tert-butyl 4-chloro-2-methylbenzoate, 95%, 95%. Offered by: Combi-blocks, Chemat. Available pack sizes: 5g, 1g, 10g, 100mg, 250mg.
Tert-butyl 4-chloro-2-methylbenzoate (CAS 1872907-39-5) is a chemical compound with the molecular formula C12H15ClO2 and a molecular weight of 226.70 g/mol. IUPAC name: tert-butyl 4-chloro-2-methylbenzoate. InChIKey: JKNDTXOAXSLGBX-UHFFFAOYSA-N.
| Molecular formula | C12H15ClO2 |
|---|---|
| Molecular weight | 226.70 g/mol |
| IUPAC name | tert-butyl 4-chloro-2-methylbenzoate |
| InChIKey | JKNDTXOAXSLGBX-UHFFFAOYSA-N |
| SMILES | CC1=C(C=CC(=C1)Cl)C(=O)OC(C)(C)C |
Computed by PubChem (NCBI)