Products 1160257-82-8

CAS 1160257-82-8 is the registry number for 2-(2,3-Dimethylphenoxy)-2-methylpropanoyl chloride, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 250mg, 1g.

Structural formula: {0} (CAS {1})

2-(2,3-dimethylphenoxy)-2-methylpropanoyl chloride (CAS 1160257-82-8) is a chemical compound with the molecular formula C12H15ClO2 and a molecular weight of 226.70 g/mol. IUPAC name: 2-(2,3-dimethylphenoxy)-2-methylpropanoyl chloride. InChIKey: SWIZSCQQZUXXIC-UHFFFAOYSA-N.

Identity
Molecular formulaC12H15ClO2
Molecular weight226.70 g/mol
IUPAC name2-(2,3-dimethylphenoxy)-2-methylpropanoyl chloride
InChIKeySWIZSCQQZUXXIC-UHFFFAOYSA-N
SMILESCC1=C(C(=CC=C1)OC(C)(C)C(=O)Cl)C

Computed by PubChem (NCBI)