CAS 66227-19-8 appears in our catalog under these names: 2-(3,5-Dimethylphenoxy)butanoyl chloride, 95%, 2-(3,5-Dimethylphenoxy)butanoyl chloride, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 250mg, 1g, 5g.
2-(3,5-dimethylphenoxy)butanoyl chloride (CAS 66227-19-8) is a chemical compound with the molecular formula C12H15ClO2 and a molecular weight of 226.70 g/mol. IUPAC name: 2-(3,5-dimethylphenoxy)butanoyl chloride. InChIKey: YQCBRBMIKOTNPC-UHFFFAOYSA-N.
| Molecular formula | C12H15ClO2 |
|---|---|
| Molecular weight | 226.70 g/mol |
| IUPAC name | 2-(3,5-dimethylphenoxy)butanoyl chloride |
| InChIKey | YQCBRBMIKOTNPC-UHFFFAOYSA-N |
| SMILES | CCC(C(=O)Cl)OC1=CC(=CC(=C1)C)C |
Computed by PubChem (NCBI)