CAS 63403-08-7 appears in our catalog under these names: 2-(P-Tolyloxy)-3-methylbutanoyl chloride, 95%, 3-Methyl-2-(p-tolyloxy)butanoyl chloride, 95%, 95%. Offered by: Combi-blocks, Chemat. Available pack sizes: 250mg, 1g, 100mg.
3-methyl-2-(4-methylphenoxy)butanoyl chloride (CAS 63403-08-7) is a chemical compound with the molecular formula C12H15ClO2 and a molecular weight of 226.70 g/mol. IUPAC name: 3-methyl-2-(4-methylphenoxy)butanoyl chloride. InChIKey: UEFHSDRXLCGKST-UHFFFAOYSA-N.
| Molecular formula | C12H15ClO2 |
|---|---|
| Molecular weight | 226.70 g/mol |
| IUPAC name | 3-methyl-2-(4-methylphenoxy)butanoyl chloride |
| InChIKey | UEFHSDRXLCGKST-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)OC(C(C)C)C(=O)Cl |
Computed by PubChem (NCBI)