CAS 24473-06-1 appears in our catalog under these names: 1–(4–chlorophenoxy)–3,3–dimethylbutan–2–one, 1-(4-chlorophenoxy)-3,3-dimethylbutan-2-one, 1-(4-Chlorophenoxy)-3,3-dimethylbutan-2-one, 95%. Offered by: GLPBio, Chemat, Combi-blocks, Fluorochem. Available pack sizes: 100mg, 1g, 250mg, 5g.
1-(4-chlorophenoxy)-3,3-dimethylbutan-2-one (CAS 24473-06-1) is a chemical compound with the molecular formula C12H15ClO2 and a molecular weight of 226.70 g/mol. IUPAC name: 1-(4-chlorophenoxy)-3,3-dimethylbutan-2-one. InChIKey: WISVKXCNQOLCJL-UHFFFAOYSA-N.
| Molecular formula | C12H15ClO2 |
|---|---|
| Molecular weight | 226.70 g/mol |
| IUPAC name | 1-(4-chlorophenoxy)-3,3-dimethylbutan-2-one |
| InChIKey | WISVKXCNQOLCJL-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C(=O)COC1=CC=C(C=C1)Cl |
Computed by PubChem (NCBI)