cas: 25981-83-3 — see every product listed under this CAS number, including other names
5-Chloro-2,3,3-trimethyl-3H-indole, 98%, 98% (CAS 25981-83-3) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch113RAV-1g |
| cas | 25981-83-3 |
| size | 1g |
| availability | 50g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 1g | 93.20 Pln | |
| Chemat | 5g | 174.80 Pln | |
| Chemat | 10g | 290.00 Pln | |
| Chemat | 25g | 462.80 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
5-chloro-2,3,3-trimethylindole (CAS 25981-83-3) is a chemical compound with the molecular formula C11H12ClN and a molecular weight of 193.67 g/mol. IUPAC name: 5-chloro-2,3,3-trimethylindole. InChIKey: GSKATGIMEUGNJN-UHFFFAOYSA-N.
| Molecular formula | C11H12ClN |
|---|---|
| Molecular weight | 193.67 g/mol |
| IUPAC name | 5-chloro-2,3,3-trimethylindole |
| InChIKey | GSKATGIMEUGNJN-UHFFFAOYSA-N |
| SMILES | CC1=NC2=C(C1(C)C)C=C(C=C2)Cl |
Computed by PubChem (NCBI)