CAS 111180-78-0 appears in our catalog under these names: 1-Amino-2-methylnaphthalene hydrochloride, 95%, 1–Amino–2–methylnaphthalene Hydrochloride, 1-Amino-2-methylnaphthalene Hydrochloride, 1-Amino-2-methylnaphthalene Hydrochloride, >98.0%(HPLC)(N), 2-Methylnaphthalen-1-amine hydrochloride. Offered by: Combi-blocks, GLPBio, Biosynth, TCI, Chemat. Available pack sizes: 25g, 1g, 5g, 100g, 10g.
2-methylnaphthalen-1-amine;hydrochloride (CAS 111180-78-0) is a chemical compound with the molecular formula C11H12ClN and a molecular weight of 193.67 g/mol. IUPAC name: 2-methylnaphthalen-1-amine;hydrochloride. InChIKey: PEBKGVSIRFSIGW-UHFFFAOYSA-N.
| Molecular formula | C11H12ClN |
|---|---|
| Molecular weight | 193.67 g/mol |
| IUPAC name | 2-methylnaphthalen-1-amine;hydrochloride |
| InChIKey | PEBKGVSIRFSIGW-UHFFFAOYSA-N |
| SMILES | CC1=C(C2=CC=CC=C2C=C1)N.Cl |
Computed by PubChem (NCBI)