CAS 39110-74-2 appears in our catalog under these names: Naphthalen-1-ylmethanamine hydrochloride, 96%, Naphthalen–1–ylmethanamine hydrochloride, 1-(Aminomethyl)naphthalene Hydrochloride, Naphthalen-1-ylmethanamine hydrochloride 97%, Naphthalen-1-ylmethanamine hydrochloride, 97%, 97%. Offered by: Combi-blocks, GLPBio, Biosynth, Ambeed, Chemat. Available pack sizes: 10g, 25g, 1g, 5g, 2,5g, 0,25g.
Naphthalen-1-ylmethanamine;hydrochloride (CAS 39110-74-2) is a chemical compound with the molecular formula C11H12ClN and a molecular weight of 193.67 g/mol. IUPAC name: naphthalen-1-ylmethanamine;hydrochloride. InChIKey: NEXZCFUBZJBRCP-UHFFFAOYSA-N.
| Molecular formula | C11H12ClN |
|---|---|
| Molecular weight | 193.67 g/mol |
| IUPAC name | naphthalen-1-ylmethanamine;hydrochloride |
| InChIKey | NEXZCFUBZJBRCP-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C=CC=C2CN.Cl |
Computed by PubChem (NCBI)