CAS 53826-01-0 is the registry number for 2,8-Dimethylquinoline hydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
2,8-dimethylquinoline;hydrochloride (CAS 53826-01-0) is a chemical compound with the molecular formula C11H12ClN and a molecular weight of 193.67 g/mol. IUPAC name: 2,8-dimethylquinoline;hydrochloride. InChIKey: XWNXFGYTPWEYQE-UHFFFAOYSA-N.
| Molecular formula | C11H12ClN |
|---|---|
| Molecular weight | 193.67 g/mol |
| IUPAC name | 2,8-dimethylquinoline;hydrochloride |
| InChIKey | XWNXFGYTPWEYQE-UHFFFAOYSA-N |
| SMILES | CC1=C2C(=CC=C1)C=CC(=N2)C.Cl |
Computed by PubChem (NCBI)