CAS 1934841-09-4 is the registry number for 5'-Chloro-2',3'-dihydrospiro[azetidine-2,1'-indene], 95%. Offered by: Chemat Brand. Available pack sizes: on request.
6-chlorospiro[1,2-dihydroindene-3,2'-azetidine] (CAS 1934841-09-4) is a chemical compound with the molecular formula C11H12ClN and a molecular weight of 193.67 g/mol. IUPAC name: 6-chlorospiro[1,2-dihydroindene-3,2'-azetidine]. InChIKey: GQWASVXRRLTEQM-UHFFFAOYSA-N.
| Molecular formula | C11H12ClN |
|---|---|
| Molecular weight | 193.67 g/mol |
| IUPAC name | 6-chlorospiro[1,2-dihydroindene-3,2'-azetidine] |
| InChIKey | GQWASVXRRLTEQM-UHFFFAOYSA-N |
| SMILES | C1CC2(CCN2)C3=C1C=C(C=C3)Cl |
Computed by PubChem (NCBI)