CAS 1255574-45-8 is the registry number for 6,8-Dimethylquinoline hydrochloride, 96%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 25g, 5g, 100g, 1g.
6,8-dimethylquinoline;hydrochloride (CAS 1255574-45-8) is a chemical compound with the molecular formula C11H12ClN and a molecular weight of 193.67 g/mol. IUPAC name: 6,8-dimethylquinoline;hydrochloride. InChIKey: URHCKNOJIHABGM-UHFFFAOYSA-N.
| Molecular formula | C11H12ClN |
|---|---|
| Molecular weight | 193.67 g/mol |
| IUPAC name | 6,8-dimethylquinoline;hydrochloride |
| InChIKey | URHCKNOJIHABGM-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C2C(=C1)C=CC=N2)C.Cl |
Computed by PubChem (NCBI)