cas: 352534-86-2 — see every product listed under this CAS number, including other names
5-Chloro-2-ethoxyphenylboronic acid 98% (CAS 352534-86-2) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g, 100g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A184960-1g |
| cas | 352534-86-2 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 1g | 120.06 Pln | |
| Ambeed | 5g | 181.25 Pln | |
| Ambeed | 10g | 286.94 Pln | |
| Ambeed | 25g | 409.31 Pln | |
| Ambeed | 100g | 1176.94 Pln |
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A184960 |
(5-chloro-2-ethoxyphenyl)boronic acid (CAS 352534-86-2) is a chemical compound with the molecular formula C8H10BClO3 and a molecular weight of 200.43 g/mol. IUPAC name: (5-chloro-2-ethoxyphenyl)boronic acid. InChIKey: OSMBQNBPCSSVMT-UHFFFAOYSA-N.
| Molecular formula | C8H10BClO3 |
|---|---|
| Molecular weight | 200.43 g/mol |
| IUPAC name | (5-chloro-2-ethoxyphenyl)boronic acid |
| InChIKey | OSMBQNBPCSSVMT-UHFFFAOYSA-N |
| SMILES | B(C1=C(C=CC(=C1)Cl)OCC)(O)O |
Computed by PubChem (NCBI)