cas: 16634-90-5 — see every product listed under this CAS number, including other names
5-Chloro-2-hydroxy-3-nitrobenzaldehyde (CAS 16634-90-5) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 200mg. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch112WNV-1g |
| cas | 16634-90-5 |
| size | 1g |
| availability | 30g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 1g | 266.00 Pln | |
| Chemat | 5g | 765.20 Pln | |
| Chemat | 200mg | 160.40 Pln |
| delivery time | 3 weeks |
|---|
5-chloro-2-hydroxy-3-nitrobenzaldehyde (CAS 16634-90-5) is a chemical compound with the molecular formula C7H4ClNO4 and a molecular weight of 201.56 g/mol. IUPAC name: 5-chloro-2-hydroxy-3-nitrobenzaldehyde. InChIKey: YSDCZOBSHGDCCI-UHFFFAOYSA-N.
| Molecular formula | C7H4ClNO4 |
|---|---|
| Molecular weight | 201.56 g/mol |
| IUPAC name | 5-chloro-2-hydroxy-3-nitrobenzaldehyde |
| InChIKey | YSDCZOBSHGDCCI-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C(=C1C=O)O)[N+](=O)[O-])Cl |
Computed by PubChem (NCBI)