cas: 2516-95-2 — see every product listed under this CAS number, including other names
5-Chloro-2-nitrobenzoic acid 98% (CAS 2516-95-2) is a chemical reagent available from Chemat. Available pack sizes: 5g, 10g, 25g, 100g, 500g, 1000g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A146727-5g |
| cas | 2516-95-2 |
| size | 5g |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Ambeed | 5g | 120.06 Pln | |
| Ambeed | 10g | 131.19 Pln | |
| Ambeed | 25g | 147.88 Pln | |
| Ambeed | 100g | 236.88 Pln | |
| Ambeed | 500g | 832.06 Pln | |
| Ambeed | 1000g | 1377.19 Pln |
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A146727 |
5-chloro-2-nitrobenzoic acid (CAS 2516-95-2) is a chemical compound with the molecular formula C7H4ClNO4 and a molecular weight of 201.56 g/mol. IUPAC name: 5-chloro-2-nitrobenzoic acid. InChIKey: ZKUYSJHXBFFGPU-UHFFFAOYSA-N.
| Molecular formula | C7H4ClNO4 |
|---|---|
| Molecular weight | 201.56 g/mol |
| IUPAC name | 5-chloro-2-nitrobenzoic acid |
| InChIKey | ZKUYSJHXBFFGPU-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1Cl)C(=O)O)[N+](=O)[O-] |
Computed by PubChem (NCBI)