cas: 118-83-2 — see every product listed under this CAS number, including other names
5-Chloro-2-nitrobenzotrifluoride 98% (CAS 118-83-2) is a chemical reagent available from Chemat. Available pack sizes: 100g, 500g, 1000g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A385566-100g |
| cas | 118-83-2 |
| size | 100g |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100g | 242.44 Pln | |
| Ambeed | 500g | 503.88 Pln | |
| Ambeed | 1000g | 926.62 Pln |
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A385566 |
4-chloro-1-nitro-2-(trifluoromethyl)benzene (CAS 118-83-2) is a chemical compound with the molecular formula C7H3ClF3NO2 and a molecular weight of 225.55 g/mol. IUPAC name: 4-chloro-1-nitro-2-(trifluoromethyl)benzene. InChIKey: CFPIGEXZPWTNOR-UHFFFAOYSA-N.
| Molecular formula | C7H3ClF3NO2 |
|---|---|
| Molecular weight | 225.55 g/mol |
| IUPAC name | 4-chloro-1-nitro-2-(trifluoromethyl)benzene |
| InChIKey | CFPIGEXZPWTNOR-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1Cl)C(F)(F)F)[N+](=O)[O-] |
Computed by PubChem (NCBI)