cas: 90381-07-0 — see every product listed under this CAS number, including other names
5-Chloro-2-trifluoromethyl-benzaldehyde, 96% (CAS 90381-07-0) is a chemical reagent available from Chemat. Available pack sizes: 500mg, 5g, 10g, 25g, 100g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F032788-500MG |
| cas | 90381-07-0 |
| size | 500mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 500mg | 128.10 Pln | |
| Fluorochem | 5g | 289.50 Pln | |
| Fluorochem | 10g | 419.66 Pln | |
| Fluorochem | 25g | 627.92 Pln | |
| Fluorochem | 100g | 2330.45 Pln |
| purity | 96% |
|---|---|
| delivery time | 2-3 weeks |
5-chloro-2-(trifluoromethyl)benzaldehyde (CAS 90381-07-0) is a chemical compound with the molecular formula C8H4ClF3O and a molecular weight of 208.56 g/mol. IUPAC name: 5-chloro-2-(trifluoromethyl)benzaldehyde. InChIKey: CVRLMVFONQYBOC-UHFFFAOYSA-N.
| Molecular formula | C8H4ClF3O |
|---|---|
| Molecular weight | 208.56 g/mol |
| IUPAC name | 5-chloro-2-(trifluoromethyl)benzaldehyde |
| InChIKey | CVRLMVFONQYBOC-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1Cl)C=O)C(F)(F)F |
Computed by PubChem (NCBI)