cas: 1033463-33-0 — see every product listed under this CAS number, including other names
5-Chloro-3-nitro-1H-pyrrolo[2,3-b]pyridine, 97% (CAS 1033463-33-0) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F441688-100MG |
| cas | 1033463-33-0 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 1294.35 Pln | |
| Fluorochem | 250mg | 2122.19 Pln |
| purity | 97% |
|---|---|
| delivery time | 3-4 weeks |
5-chloro-3-nitro-1H-pyrrolo[2,3-b]pyridine (CAS 1033463-33-0) is a chemical compound with the molecular formula C7H4ClN3O2 and a molecular weight of 197.58 g/mol. IUPAC name: 5-chloro-3-nitro-1H-pyrrolo[2,3-b]pyridine. InChIKey: DEZAIQUWOITSPT-UHFFFAOYSA-N.
| Molecular formula | C7H4ClN3O2 |
|---|---|
| Molecular weight | 197.58 g/mol |
| IUPAC name | 5-chloro-3-nitro-1H-pyrrolo[2,3-b]pyridine |
| InChIKey | DEZAIQUWOITSPT-UHFFFAOYSA-N |
| SMILES | C1=C(C=NC2=C1C(=CN2)[N+](=O)[O-])Cl |
Computed by PubChem (NCBI)