cas: 827-44-1 — see every product listed under this CAS number, including other names
5-Chloro-3-phenyl-1,2,4-oxadiazole, 95%, 95% (CAS 827-44-1) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11G5GZ-100mg |
| cas | 827-44-1 |
| size | 100mg |
| availability | 2g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 611.60 Pln | |
| Chemat | 250mg | 1029.20 Pln | |
| Chemat | 1g | 1994.00 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
5-chloro-3-phenyl-1,2,4-oxadiazole (CAS 827-44-1) is a chemical compound with the molecular formula C8H5ClN2O and a molecular weight of 180.59 g/mol. IUPAC name: 5-chloro-3-phenyl-1,2,4-oxadiazole. InChIKey: MOJYPXFSJLVCRN-UHFFFAOYSA-N.
| Molecular formula | C8H5ClN2O |
|---|---|
| Molecular weight | 180.59 g/mol |
| IUPAC name | 5-chloro-3-phenyl-1,2,4-oxadiazole |
| InChIKey | MOJYPXFSJLVCRN-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=NOC(=N2)Cl |
Computed by PubChem (NCBI)