cas: 827-44-1 — see every product listed under this CAS number, including other names
5-Chloro-3-phenyl-1,2,4-oxadiazole, 98+% (CAS 827-44-1) is a chemical reagent available from Chemat. Available pack sizes: 25g, 10g. Offered by: AmBeed.
| brand | AmBeed |
|---|---|
| catalog number | A180485-25g |
| cas | 827-44-1 |
| size | 25g |
| availability | Synthetic Items: 0g |
| brand | size | price | |
|---|---|---|---|
| AmBeed | 25g | 12595.24 Pln | |
| AmBeed | 10g | 6332.62 Pln |
| purity | 98+% |
|---|---|
| delivery time | To be confirmed by Chemat |
5-chloro-3-phenyl-1,2,4-oxadiazole (CAS 827-44-1) is a chemical compound with the molecular formula C8H5ClN2O and a molecular weight of 180.59 g/mol. IUPAC name: 5-chloro-3-phenyl-1,2,4-oxadiazole. InChIKey: MOJYPXFSJLVCRN-UHFFFAOYSA-N.
| Molecular formula | C8H5ClN2O |
|---|---|
| Molecular weight | 180.59 g/mol |
| IUPAC name | 5-chloro-3-phenyl-1,2,4-oxadiazole |
| InChIKey | MOJYPXFSJLVCRN-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=NOC(=N2)Cl |
Computed by PubChem (NCBI)