cas: 1315364-91-0 — see every product listed under this CAS number, including other names
5-Chloropyrazolo[1,5-a]pyrimidine-3-carboxylic acid 97% (CAS 1315364-91-0) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A829730-100mg |
| cas | 1315364-91-0 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 259.12 Pln | |
| Ambeed | 250mg | 320.31 Pln | |
| Ambeed | 1g | 375.94 Pln | |
| Ambeed | 5g | 1282.62 Pln |
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A829730 |
5-chloropyrazolo[1,5-a]pyrimidine-3-carboxylic acid (CAS 1315364-91-0) is a chemical compound with the molecular formula C7H4ClN3O2 and a molecular weight of 197.58 g/mol. IUPAC name: 5-chloropyrazolo[1,5-a]pyrimidine-3-carboxylic acid. InChIKey: SAMKKKTWKGAXIC-UHFFFAOYSA-N.
| Molecular formula | C7H4ClN3O2 |
|---|---|
| Molecular weight | 197.58 g/mol |
| IUPAC name | 5-chloropyrazolo[1,5-a]pyrimidine-3-carboxylic acid |
| InChIKey | SAMKKKTWKGAXIC-UHFFFAOYSA-N |
| SMILES | C1=CN2C(=C(C=N2)C(=O)O)N=C1Cl |
Computed by PubChem (NCBI)