cas: 942-26-7 — see every product listed under this CAS number, including other names
5-Chlorotryptamine hydrochloride, 98%, 98% (CAS 942-26-7) is a chemical reagent available from Chemat. Available pack sizes: 50g, 75g, 1g, 5g, 10g, 100g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch114EXY-50g |
| cas | 942-26-7 |
| size | 50g |
| availability | 400g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 50g | 621.20 Pln | |
| Chemat | 75g | 894.80 Pln | |
| Chemat | 1g | 74.00 Pln | |
| Chemat | 5g | 117.20 Pln | |
| Chemat | 10g | 170.00 Pln | |
| Chemat | 100g | 966.80 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
2-(5-chloro-1H-indol-3-yl)ethanamine;hydrochloride (CAS 942-26-7) is a chemical compound with the molecular formula C10H12Cl2N2 and a molecular weight of 231.12 g/mol. IUPAC name: 2-(5-chloro-1H-indol-3-yl)ethanamine;hydrochloride. InChIKey: PBANXRNIXGEHPZ-UHFFFAOYSA-N.
| Molecular formula | C10H12Cl2N2 |
|---|---|
| Molecular weight | 231.12 g/mol |
| IUPAC name | 2-(5-chloro-1H-indol-3-yl)ethanamine;hydrochloride |
| InChIKey | PBANXRNIXGEHPZ-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C1Cl)C(=CN2)CCN.Cl |
Computed by PubChem (NCBI)