cas: 10435-57-1 — see every product listed under this CAS number, including other names
5-Cyano-2-hydroxybenzoic acid 95% (CAS 10435-57-1) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A485233-100mg |
| cas | 10435-57-1 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 331.44 Pln | |
| Ambeed | 250mg | 487.19 Pln | |
| Ambeed | 1g | 1221.44 Pln | |
| Ambeed | 5g | 3424.19 Pln |
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A485233 |
5-cyano-2-hydroxybenzoic acid (CAS 10435-57-1) is a chemical compound with the molecular formula C8H5NO3 and a molecular weight of 163.13 g/mol. IUPAC name: 5-cyano-2-hydroxybenzoic acid. InChIKey: XUNYRQCTAPBWCF-UHFFFAOYSA-N.
| Molecular formula | C8H5NO3 |
|---|---|
| Molecular weight | 163.13 g/mol |
| IUPAC name | 5-cyano-2-hydroxybenzoic acid |
| InChIKey | XUNYRQCTAPBWCF-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1C#N)C(=O)O)O |
Computed by PubChem (NCBI)