cas: 61135-33-9 — see every product listed under this CAS number, including other names
5-Ethynyl-2'-dU, 97%, 97% (CAS 61135-33-9) is a chemical reagent available from Chemat. Available pack sizes: 50mg, 100mg, 250mg, 500mg, 1g, 5g, 10g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11IATB-50mg |
| cas | 61135-33-9 |
| size | 50mg |
| availability | 20g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 50mg | 107.60 Pln | |
| Chemat | 100mg | 117.20 Pln | |
| Chemat | 250mg | 160.40 Pln | |
| Chemat | 500mg | 237.20 Pln | |
| Chemat | 1g | 390.80 Pln | |
| Chemat | 5g | 1686.80 Pln | |
| Chemat | 10g | 2824.40 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
5-ethynyl-2'-deoxyuridine is a pyrimidine 2'-deoxyribonucleoside having eniluracil as the nucleobase. It is functionally related to an eniluracil.
Source: ChEBI
| Molecular formula | C11H12N2O5 |
|---|---|
| Molecular weight | 252.22 g/mol |
| IUPAC name | 5-ethynyl-1-[(2R,4S,5R)-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]pyrimidine-2,4-dione |
| InChIKey | CDEURGJCGCHYFH-DJLDLDEBSA-N |
| SMILES | C#CC1=CN(C(=O)NC1=O)[C@H]2C[C@@H]([C@H](O2)CO)O |
Computed by PubChem (NCBI)