Products 153437-51-5

CAS 153437-51-5 is the registry number for 5-(Morpholin-4-yl)-2-nitrobenzoic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 100mg, 5g, 1g, 10g.

Structural formula: {0} (CAS {1})

5-morpholin-4-yl-2-nitrobenzoic acid (CAS 153437-51-5) is a chemical compound with the molecular formula C11H12N2O5 and a molecular weight of 252.22 g/mol. IUPAC name: 5-morpholin-4-yl-2-nitrobenzoic acid. InChIKey: YLZSNFZNVCUXMM-UHFFFAOYSA-N.

Identity
Molecular formulaC11H12N2O5
Molecular weight252.22 g/mol
IUPAC name5-morpholin-4-yl-2-nitrobenzoic acid
InChIKeyYLZSNFZNVCUXMM-UHFFFAOYSA-N
SMILESC1COCCN1C2=CC(=C(C=C2)[N+](=O)[O-])C(=O)O

Computed by PubChem (NCBI)