CAS 1214026-62-6 is the registry number for 3-[1-(2-Furylmethyl)-2,5-dioxoimidazolidin-4-yl]propanoic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
3-[1-(furan-2-ylmethyl)-2,5-dioxoimidazolidin-4-yl]propanoic acid (CAS 1214026-62-6) is a chemical compound with the molecular formula C11H12N2O5 and a molecular weight of 252.22 g/mol. IUPAC name: 3-[1-(furan-2-ylmethyl)-2,5-dioxoimidazolidin-4-yl]propanoic acid. InChIKey: QAQCNEQMIWQYAW-UHFFFAOYSA-N.
| Molecular formula | C11H12N2O5 |
|---|---|
| Molecular weight | 252.22 g/mol |
| IUPAC name | 3-[1-(furan-2-ylmethyl)-2,5-dioxoimidazolidin-4-yl]propanoic acid |
| InChIKey | QAQCNEQMIWQYAW-UHFFFAOYSA-N |
| SMILES | C1=COC(=C1)CN2C(=O)C(NC2=O)CCC(=O)O |
Computed by PubChem (NCBI)