cas: 446-36-6 — see every product listed under this CAS number, including other names
5-Fluoro-2-nitrophenol, 98%, 98% (CAS 446-36-6) is a chemical reagent available from Chemat. Available pack sizes: 5g, 10g, 25g, 100g, 500g, 250g, 1kg. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch114MRA-5g |
| cas | 446-36-6 |
| size | 5g |
| availability | 5000g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 5g | 74.00 Pln | |
| Chemat | 10g | 78.80 Pln | |
| Chemat | 25g | 83.60 Pln | |
| Chemat | 100g | 174.80 Pln | |
| Chemat | 500g | 652.80 Pln | |
| Chemat | 250g | 342.80 Pln | |
| Chemat | 1kg | 1067.60 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
5-fluoro-2-nitrophenol (CAS 446-36-6) is a chemical compound with the molecular formula C6H4FNO3 and a molecular weight of 157.10 g/mol. IUPAC name: 5-fluoro-2-nitrophenol. InChIKey: QQURWFRNETXFTN-UHFFFAOYSA-N.
| Molecular formula | C6H4FNO3 |
|---|---|
| Molecular weight | 157.10 g/mol |
| IUPAC name | 5-fluoro-2-nitrophenol |
| InChIKey | QQURWFRNETXFTN-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1F)O)[N+](=O)[O-] |
Computed by PubChem (NCBI)