cas: 446-36-6 — see every product listed under this CAS number, including other names
5-Fluoro-2-nitrophenol, 99% (CAS 446-36-6) is a chemical reagent available from Chemat. Available pack sizes: 25g, 100g. Offered by: Thermo Scientific (Acros).
| brand | Thermo Scientific (Acros) |
|---|---|
| catalog number | 241970250 |
| cas | 446-36-6 |
| size | 25g |
| availability | availability |
| brand | size | price | |
|---|---|---|---|
| Thermo Scientific (Acros) | 25g | 289.54 Pln | |
| Thermo Scientific (Acros) | 100g | 828.53 Pln |
| delivery time | 2-3 weeks |
|---|---|
| category | Chemicals |
| purity | 99% |
5-fluoro-2-nitrophenol (CAS 446-36-6) is a chemical compound with the molecular formula C6H4FNO3 and a molecular weight of 157.10 g/mol. IUPAC name: 5-fluoro-2-nitrophenol. InChIKey: QQURWFRNETXFTN-UHFFFAOYSA-N.
| Molecular formula | C6H4FNO3 |
|---|---|
| Molecular weight | 157.10 g/mol |
| IUPAC name | 5-fluoro-2-nitrophenol |
| InChIKey | QQURWFRNETXFTN-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1F)O)[N+](=O)[O-] |
Computed by PubChem (NCBI)