5-Fluoro-3-methyl-2-nitrobenzoic acid, 97%
cas: 952479-96-8 — see every product listed under this CAS number, including other names
5-Fluoro-3-methyl-2-nitrobenzoic acid, 97% (CAS 952479-96-8) is a chemical reagent available from Chemat. Available pack sizes: 10g, 100mg, 250mg, 1g, 5g. Offered by: AmBeed, Fluorochem.
| brand | AmBeed |
|---|---|
| catalog number | A929779-10g |
| cas | 952479-96-8 |
| size | 10g |
| availability | Synthetic Items: 0g |
Documents:
Safety Data Sheet (MSDS)
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| AmBeed | 10g | 13213.69 Pln | |
| Fluorochem | 100mg | 378.01 Pln | |
| Fluorochem | 250mg | 685.19 Pln | |
| Fluorochem | 1g | 1601.54 Pln | |
| Fluorochem | 5g | 4902.46 Pln | |
| Fluorochem | 10g | 8229.41 Pln |
properties
| purity | 97% |
|---|---|
| delivery time | To be confirmed by Chemat |
5-fluoro-3-methyl-2-nitrobenzoic acid (CAS 952479-96-8) is a chemical compound with the molecular formula C8H6FNO4 and a molecular weight of 199.14 g/mol. IUPAC name: 5-fluoro-3-methyl-2-nitrobenzoic acid. InChIKey: WKBHDCDQVWTTJV-UHFFFAOYSA-N.
| Molecular formula | C8H6FNO4 |
|---|---|
| Molecular weight | 199.14 g/mol |
| IUPAC name | 5-fluoro-3-methyl-2-nitrobenzoic acid |
| InChIKey | WKBHDCDQVWTTJV-UHFFFAOYSA-N |
| SMILES | CC1=CC(=CC(=C1[N+](=O)[O-])C(=O)O)F |
Computed by PubChem (NCBI)