cas: 837373-16-7 — see every product listed under this CAS number, including other names
5-Fluoro-7-methoxy-3,4-dihydronaphthalen-1(2H)-one, 97% (CAS 837373-16-7) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F497635-100MG |
| cas | 837373-16-7 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 830.98 Pln | |
| Fluorochem | 250mg | 1591.12 Pln | |
| Fluorochem | 500mg | 2543.91 Pln | |
| Fluorochem | 1g | 3600.83 Pln |
| purity | 97% |
|---|---|
| delivery time | 3-4 weeks |
5-fluoro-7-methoxy-3,4-dihydro-2H-naphthalen-1-one (CAS 837373-16-7) is a chemical compound with the molecular formula C11H11FO2 and a molecular weight of 194.20 g/mol. IUPAC name: 5-fluoro-7-methoxy-3,4-dihydro-2H-naphthalen-1-one. InChIKey: PZESXOJHITYOCC-UHFFFAOYSA-N.
| Molecular formula | C11H11FO2 |
|---|---|
| Molecular weight | 194.20 g/mol |
| IUPAC name | 5-fluoro-7-methoxy-3,4-dihydro-2H-naphthalen-1-one |
| InChIKey | PZESXOJHITYOCC-UHFFFAOYSA-N |
| SMILES | COC1=CC2=C(CCCC2=O)C(=C1)F |
Computed by PubChem (NCBI)