cas: 906564-59-8 — see every product listed under this CAS number, including other names
5-Hexynoic Acid Nhs Ester, 97%, 97% (CAS 906564-59-8) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g, 25g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch114MS8-100mg |
| cas | 906564-59-8 |
| size | 100mg |
| availability | 100g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 170.00 Pln | |
| Chemat | 250mg | 218.00 Pln | |
| Chemat | 1g | 486.80 Pln | |
| Chemat | 5g | 1912.40 Pln | |
| Chemat | 10g | 3165.20 Pln | |
| Chemat | 25g | 6266.00 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
(2,5-dioxopyrrolidin-1-yl) hex-5-ynoate (CAS 906564-59-8) is a chemical compound with the molecular formula C10H11NO4 and a molecular weight of 209.20 g/mol. IUPAC name: (2,5-dioxopyrrolidin-1-yl) hex-5-ynoate. InChIKey: CXSSWEBEHUYETJ-UHFFFAOYSA-N.
| Molecular formula | C10H11NO4 |
|---|---|
| Molecular weight | 209.20 g/mol |
| IUPAC name | (2,5-dioxopyrrolidin-1-yl) hex-5-ynoate |
| InChIKey | CXSSWEBEHUYETJ-UHFFFAOYSA-N |
| SMILES | C#CCCCC(=O)ON1C(=O)CCC1=O |
Computed by PubChem (NCBI)