cas: 610-37-7 — see every product listed under this CAS number, including other names
5-Hydroxy-2-nitrobenzoic acid, 95% (CAS 610-37-7) is a chemical reagent available from Chemat. Available pack sizes: 1g, 10g, 50g. Offered by: Thermo Scientific.
| brand | Thermo Scientific |
|---|---|
| catalog number | RH00465DA |
| cas | 610-37-7 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Thermo Scientific | 1g | 100.80 Pln | |
| Thermo Scientific | 10g | 768.71 Pln | |
| Thermo Scientific | 50g | 2453.77 Pln |
| delivery time | 2-3 weeks |
|---|---|
| category | Chemicals |
| purity | 95% |
5-hydroxy-2-nitrobenzoic acid (CAS 610-37-7) is a chemical compound with the molecular formula C7H5NO5 and a molecular weight of 183.12 g/mol. IUPAC name: 5-hydroxy-2-nitrobenzoic acid. InChIKey: BUHKQTKKZAXSMH-UHFFFAOYSA-N.
| Molecular formula | C7H5NO5 |
|---|---|
| Molecular weight | 183.12 g/mol |
| IUPAC name | 5-hydroxy-2-nitrobenzoic acid |
| InChIKey | BUHKQTKKZAXSMH-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1O)C(=O)O)[N+](=O)[O-] |
Computed by PubChem (NCBI)