cas: 610-37-7 — see every product listed under this CAS number, including other names
5-Hydroxy-2-nitrobenzoic acid, 97% (CAS 610-37-7) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g, 100g, 500g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F065630-1G |
| cas | 610-37-7 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 102.07 Pln | |
| Fluorochem | 5g | 122.89 Pln | |
| Fluorochem | 10g | 128.10 Pln | |
| Fluorochem | 25g | 200.99 Pln | |
| Fluorochem | 100g | 643.54 Pln | |
| Fluorochem | 500g | 3002.09 Pln |
| purity | 97% |
|---|---|
| delivery time | 2-3 weeks |
5-hydroxy-2-nitrobenzoic acid (CAS 610-37-7) is a chemical compound with the molecular formula C7H5NO5 and a molecular weight of 183.12 g/mol. IUPAC name: 5-hydroxy-2-nitrobenzoic acid. InChIKey: BUHKQTKKZAXSMH-UHFFFAOYSA-N.
| Molecular formula | C7H5NO5 |
|---|---|
| Molecular weight | 183.12 g/mol |
| IUPAC name | 5-hydroxy-2-nitrobenzoic acid |
| InChIKey | BUHKQTKKZAXSMH-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1O)C(=O)O)[N+](=O)[O-] |
Computed by PubChem (NCBI)