cas: 3952-69-0 — see every product listed under this CAS number, including other names
5-Hydroxy-4H-chromen-4-one, 95%, 95% (CAS 3952-69-0) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch1189KQ-100mg |
| cas | 3952-69-0 |
| size | 100mg |
| availability | 5g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 400.40 Pln | |
| Chemat | 250mg | 635.60 Pln | |
| Chemat | 1g | 1610.00 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
5-hydroxychromen-4-one (CAS 3952-69-0) is a chemical compound with the molecular formula C9H6O3 and a molecular weight of 162.14 g/mol. IUPAC name: 5-hydroxychromen-4-one. InChIKey: CJMXMDVAKVSKFI-UHFFFAOYSA-N.
| Molecular formula | C9H6O3 |
|---|---|
| Molecular weight | 162.14 g/mol |
| IUPAC name | 5-hydroxychromen-4-one |
| InChIKey | CJMXMDVAKVSKFI-UHFFFAOYSA-N |
| SMILES | C1=CC(=C2C(=O)C=COC2=C1)O |
Computed by PubChem (NCBI)