5-Hydroxybenzo[de]isochromene-1,3-dione, 98%
cas: 23204-36-6 — see every product listed under this CAS number, including other names
5-Hydroxybenzo[de]isochromene-1,3-dione, 98% (CAS 23204-36-6) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 25g, 100g, 100mg. Offered by: Fluorochem, Chemat.
| brand | Fluorochem |
|---|---|
| catalog number | F322013-250MG |
| cas | 23204-36-6 |
| size | 250mg |
| availability | In Stock China |
Documents:
Safety Data Sheet (MSDS)
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 185.37 Pln | |
| Fluorochem | 1g | 294.71 Pln | |
| Fluorochem | 5g | 914.28 Pln | |
| Fluorochem | 10g | 1716.08 Pln | |
| Fluorochem | 25g | 2663.66 Pln | |
| Fluorochem | 100g | 10166.23 Pln | |
| Chemat | 100mg | 98.00 Pln | |
| Chemat | 250mg | 102.80 Pln | |
| Chemat | 1g | 170.00 Pln | |
| Chemat | 5g | 491.60 Pln | |
| Chemat | 10g | 866.00 Pln | |
| Chemat | 25g | 1931.60 Pln |
properties
| purity | 98% |
|---|---|
| dual use | No |
| currency | EUR |
| delivery time | 2-3 weeks |
| category | Odczynniki chemiczne |
7-hydroxy-3-oxatricyclo[7.3.1.05,13]trideca-1(12),5(13),6,8,10-pentaene-2,4-dione (CAS 23204-36-6) is a chemical compound with the molecular formula C12H6O4 and a molecular weight of 214.17 g/mol. IUPAC name: 7-hydroxy-3-oxatricyclo[7.3.1.05,13]trideca-1(12),5(13),6,8,10-pentaene-2,4-dione. InChIKey: FKVNZFAMXGMPOU-UHFFFAOYSA-N.
| Molecular formula | C12H6O4 |
|---|---|
| Molecular weight | 214.17 g/mol |
| IUPAC name | 7-hydroxy-3-oxatricyclo[7.3.1.05,13]trideca-1(12),5(13),6,8,10-pentaene-2,4-dione |
| InChIKey | FKVNZFAMXGMPOU-UHFFFAOYSA-N |
| SMILES | C1=CC2=CC(=CC3=C2C(=C1)C(=O)OC3=O)O |
Computed by PubChem (NCBI)
Synonyms:
3-Hydroxy-1,8-naphthalic anhydride, 5-Hydroxybenzo[de]isochromene-1,3-dione, 5-Hydroxy-1H,3H-benzo[de]isochromene-1,3-dione, 1H,3H-Naphtho[1,8-cd]pyran-1,3-dione, 5-hydroxy-, 5-Hydroxy-1H,3H-benzo[de]isochromene-1,3-dione #, 5-Hydroxy-1H,3H-naphtho[1,8-cd]pyran-1,3-dione, 11-hydroxy-3-oxatricyclo[7.3.1.0,]trideca-1(13),5,7,9,11-pentaene-2,4-dione