Products 4843-45-2
CAS 4843-45-2 is the registry number for 3,3'-(1,4-Phenylene)dipropiolic acid, 97%. Offered by: Chemat Brand. Available pack sizes: on request.
3-[4-(2-carboxyethynyl)phenyl]prop-2-ynoic acid (CAS 4843-45-2) is a chemical compound with the molecular formula C12H6O4 and a molecular weight of 214.17 g/mol. IUPAC name: 3-[4-(2-carboxyethynyl)phenyl]prop-2-ynoic acid. InChIKey: IUCPZNVTXMASAX-UHFFFAOYSA-N.
| Molecular formula | C12H6O4 |
|---|---|
| Molecular weight | 214.17 g/mol |
| IUPAC name | 3-[4-(2-carboxyethynyl)phenyl]prop-2-ynoic acid |
| InChIKey | IUCPZNVTXMASAX-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C#CC(=O)O)C#CC(=O)O |
Computed by PubChem (NCBI)
Synonyms:
3,3'-(1,4-Phenylene)bis(2-propynoic acid), 3,3'-(1,4-Phenylene)bis[2-propynoic acid], 3,3'-(1,4-phenylene)dipropiolic acid, 2-Propynoic acid, 3,3'-(1,4-phenylene)bis-, 1,4-phenylene bispropiolic acid, IUCPZNVTXMASAX-UHFFFAOYSA-N, 3,3'-(1,4-Phenylene)di(prop-2-ynoic acid), 3,3a(2)-(1,4-Phenylene)bis[2-propynoic acid]