CAS 23204-36-6 appears in our catalog under these names: 3-Hydroxy-1,8-naphthalic anhydride, 97%, 3–Hydroxy–1,8–naphthalic Anhydride, 3-Hydroxy-1,8-naphthalic Anhydride, >98.0%(T), 5-Hydroxybenzo[de]isochromene-1,3-dione 95%, 5-Hydroxybenzo[de]isochromene-1,3-dione, 98%, 98%. Offered by: Combi-blocks, GLPBio, TCI, Ambeed, Chemat. Available pack sizes: 5g, 25g, 10g, 1g, 250mg, 100mg, 100g.
7-hydroxy-3-oxatricyclo[7.3.1.05,13]trideca-1(12),5(13),6,8,10-pentaene-2,4-dione (CAS 23204-36-6) is a chemical compound with the molecular formula C12H6O4 and a molecular weight of 214.17 g/mol. IUPAC name: 7-hydroxy-3-oxatricyclo[7.3.1.05,13]trideca-1(12),5(13),6,8,10-pentaene-2,4-dione. InChIKey: FKVNZFAMXGMPOU-UHFFFAOYSA-N.
| Molecular formula | C12H6O4 |
|---|---|
| Molecular weight | 214.17 g/mol |
| IUPAC name | 7-hydroxy-3-oxatricyclo[7.3.1.05,13]trideca-1(12),5(13),6,8,10-pentaene-2,4-dione |
| InChIKey | FKVNZFAMXGMPOU-UHFFFAOYSA-N |
| SMILES | C1=CC2=CC(=CC3=C2C(=C1)C(=O)OC3=O)O |
Computed by PubChem (NCBI)