Products 1175514-11-0
CAS 1175514-11-0 is the registry number for 7-Ethynyl-2-oxo-2H-chromene-3-carboxylic acid 95%. Offered by: Ambeed. Available pack sizes: 100mg, 250mg, 1g.
7-ethynyl-2-oxochromene-3-carboxylic acid (CAS 1175514-11-0) is a chemical compound with the molecular formula C12H6O4 and a molecular weight of 214.17 g/mol. IUPAC name: 7-ethynyl-2-oxochromene-3-carboxylic acid. InChIKey: FWOSUTJNTQHMIL-UHFFFAOYSA-N.
| Molecular formula | C12H6O4 |
|---|---|
| Molecular weight | 214.17 g/mol |
| IUPAC name | 7-ethynyl-2-oxochromene-3-carboxylic acid |
| InChIKey | FWOSUTJNTQHMIL-UHFFFAOYSA-N |
| SMILES | C#CC1=CC2=C(C=C1)C=C(C(=O)O2)C(=O)O |
Computed by PubChem (NCBI)