CAS 52083-08-6 appears in our catalog under these names: 6-Hydroxybenzo[de]isochromene-1,3-dione, 98%, 4-Hydroxy-1,8-naphthalenedicarboxylic anhydride, 98%, 98%, 6-Hydroxy-1H,3H-benzo[de]isochromene-1,3-dione, 98%. Offered by: Fluorochem, Chemat, Ambeed. Available pack sizes: 100mg, 250mg, 1g, 5g.
8-hydroxy-3-oxatricyclo[7.3.1.05,13]trideca-1(12),5(13),6,8,10-pentaene-2,4-dione (CAS 52083-08-6) is a chemical compound with the molecular formula C12H6O4 and a molecular weight of 214.17 g/mol. IUPAC name: 8-hydroxy-3-oxatricyclo[7.3.1.05,13]trideca-1(12),5(13),6,8,10-pentaene-2,4-dione. InChIKey: BFKXHILYGIQGCB-UHFFFAOYSA-N.
| Molecular formula | C12H6O4 |
|---|---|
| Molecular weight | 214.17 g/mol |
| IUPAC name | 8-hydroxy-3-oxatricyclo[7.3.1.05,13]trideca-1(12),5(13),6,8,10-pentaene-2,4-dione |
| InChIKey | BFKXHILYGIQGCB-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=CC3=C2C(=C1)C(=O)OC3=O)O |
Computed by PubChem (NCBI)