CAS 53910-13-7 appears in our catalog under these names: s-Indacene-1,3,5,7(2H,6H)-tetraone 99%, s-Indacene-1,3,5,7(2H,6H)-tetrone, 99%, 99%, s-Indacene-1,3,5,7(2H,6H)-tetrone, 98%. Offered by: Ambeed, Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g.
S-indacene-1,3,5,7-tetrone (CAS 53910-13-7) is a chemical compound with the molecular formula C12H6O4 and a molecular weight of 214.17 g/mol. IUPAC name: s-indacene-1,3,5,7-tetrone. InChIKey: IIQAKBNZSYJRLU-UHFFFAOYSA-N.
| Molecular formula | C12H6O4 |
|---|---|
| Molecular weight | 214.17 g/mol |
| IUPAC name | s-indacene-1,3,5,7-tetrone |
| InChIKey | IIQAKBNZSYJRLU-UHFFFAOYSA-N |
| SMILES | C1C(=O)C2=CC3=C(C=C2C1=O)C(=O)CC3=O |
Computed by PubChem (NCBI)