cas: 27106-12-3 — see every product listed under this CAS number, including other names
5-Mercapto-4-phenyl-2,4-dihydro-3h-1,2,4-triazol-3-one, 95+%, 95+% (CAS 27106-12-3) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11BIZF-100mg |
| cas | 27106-12-3 |
| size | 100mg |
| availability | 5g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 347.60 Pln | |
| Chemat | 250mg | 544.40 Pln | |
| Chemat | 1g | 1029.20 Pln |
| purity | 95+% |
|---|---|
| delivery time | 3 weeks |
4-phenyl-5-sulfanylidene-1,2,4-triazolidin-3-one (CAS 27106-12-3) is a chemical compound with the molecular formula C8H7N3OS and a molecular weight of 193.23 g/mol. IUPAC name: 4-phenyl-5-sulfanylidene-1,2,4-triazolidin-3-one. InChIKey: RAOXPTJDYMBTGU-UHFFFAOYSA-N.
| Molecular formula | C8H7N3OS |
|---|---|
| Molecular weight | 193.23 g/mol |
| IUPAC name | 4-phenyl-5-sulfanylidene-1,2,4-triazolidin-3-one |
| InChIKey | RAOXPTJDYMBTGU-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)N2C(=O)NNC2=S |
Computed by PubChem (NCBI)