5-Methanesulfonylfuran-2-carboxylic acid, 95%
cas: 23423-91-8 — see every product listed under this CAS number, including other names
5-Methanesulfonylfuran-2-carboxylic acid, 95% (CAS 23423-91-8) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 25g. Offered by: Ambeed, BLDpharm, Chemat.
| brand | Ambeed |
|---|---|
| catalog number | A1129210-250mg |
| cas | 23423-91-8 |
| size | 250mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 214.62 Pln | |
| Ambeed | 1g | 492.75 Pln | |
| Ambeed | 5g | 1861.13 Pln | |
| Ambeed | 25g | 6327.81 Pln | |
| BLDpharm | 250mg | 225.50 Pln | |
| BLDpharm | 1g | 525.40 Pln | |
| BLDpharm | 5g | 1997.10 Pln | |
| BLDpharm | 25g | 6817.62 Pln | |
| Chemat | 250mg | 198.80 Pln | |
| Chemat | 1g | 482.00 Pln | |
| Chemat | 5g | 1768.40 Pln | |
| Chemat | 25g | 8334.80 Pln |
properties
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks |
5-methylsulfonylfuran-2-carboxylic acid (CAS 23423-91-8) is a chemical compound with the molecular formula C6H6O5S and a molecular weight of 190.18 g/mol. IUPAC name: 5-methylsulfonylfuran-2-carboxylic acid. InChIKey: ZREDSSGHFVMCQP-UHFFFAOYSA-N.
| Molecular formula | C6H6O5S |
|---|---|
| Molecular weight | 190.18 g/mol |
| IUPAC name | 5-methylsulfonylfuran-2-carboxylic acid |
| InChIKey | ZREDSSGHFVMCQP-UHFFFAOYSA-N |
| SMILES | CS(=O)(=O)C1=CC=C(O1)C(=O)O |
Computed by PubChem (NCBI)