CAS 17724-16-2 is the registry number for 3,5-Dihydroxybenzenesulfonic acid 98%. Offered by: Ambeed. Available pack sizes: 250mg, 1g, 5g.
3,5-dihydroxybenzenesulfonic acid is a dihydroxybenzenesulfonic acid that is resorcinol in which the hydrogen meta- to both of the hydroxy groups is replaced by a sulfonic acid group. It has a role as a metabolite. It is functionally related to a resorcinol.
Source: ChEBI
| Molecular formula | C6H6O5S |
|---|---|
| Molecular weight | 190.18 g/mol |
| IUPAC name | 3,5-dihydroxybenzenesulfonic acid |
| InChIKey | KYBQHRJTFDLLFL-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C=C1O)S(=O)(=O)O)O |
Computed by PubChem (NCBI)