CAS 35857-70-6 is the registry number for Calcium Dobesilate Impurity 14. Offered by: Chemat Brand. Available pack sizes: on request.
2,3-dihydroxybenzenesulfonic acid is a dihydroxybenzenesulfonic acid in which the hydroxy groups are located at positions 2 and 3. It is a conjugate acid of a 2,3-dihydroxybenzenesulfonate.
Source: ChEBI
| Molecular formula | C6H6O5S |
|---|---|
| Molecular weight | 190.18 g/mol |
| IUPAC name | 2,3-dihydroxybenzenesulfonic acid |
| InChIKey | VZYDKJOUEPFKMW-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1)S(=O)(=O)O)O)O |
Computed by PubChem (NCBI)